C17H19N3O2 — CID 3609219
N'-[4-(furan-2-yl)buta-1,3-dien-2-yl]-2-(4-methylanilino)acetohydrazide (PubChem CID 3609219) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N'-[4-(furan-2-yl)buta-1,3-dien-2-yl]-2-(4-methylanilino)acetohydrazide.
| Compound Name | N'-[4-(furan-2-yl)buta-1,3-dien-2-yl]-2-(4-methylanilino)acetohydrazide |
|---|---|
| PubChem CID | 3609219 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N'-[4-(furan-2-yl)buta-1,3-dien-2-yl]-2-(4-methylanilino)acetohydrazide |
| SMILES | C=C(C=Cc1ccco1)NNC(=O)CNc1ccc(C)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-5-8-15(9-6-13)18-12-17(21)20-19-14(2)7-10-16-4-3-11-22-16/h3-11,18-19H,2,12H2,1H3,(H,20,21) |
| InChIKey | NWNRZGQNUHMIOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|