C9H11N3O2 — CID 5192993
[4-(furan-2-yl)buta-1,3-dien-2-ylamino]urea (PubChem CID 5192993) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is [4-(furan-2-yl)buta-1,3-dien-2-ylamino]urea.
| Compound Name | [4-(furan-2-yl)buta-1,3-dien-2-ylamino]urea |
|---|---|
| PubChem CID | 5192993 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | [4-(furan-2-yl)buta-1,3-dien-2-ylamino]urea |
| SMILES | C=C(C=Cc1ccco1)NNC(N)=O |
| InChI | InChI=1S/C9H11N3O2/c1-7(11-12-9(10)13)4-5-8-3-2-6-14-8/h2-6,11H,1H2,(H3,10,12,13) |
| InChIKey | ODWFKWRWMWJCSR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|