C25H20BrN3O3S2 — CID 3628701
N-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]phenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 3628701) has the molecular formula C25H20BrN3O3S2 and a molecular weight of 554.49 g/mol. Its IUPAC name is N-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]phenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | N-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3628701 |
| Molecular Formula | C25H20BrN3O3S2 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | N-[[3-[(2-bromo-5-methylphenyl)sulfamoyl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | Cc1ccc(Br)c(NS(=O)(=O)c2cccc(NC(=S)NC(=O)c3ccc4ccccc4c3)c2)c1 |
| InChI | InChI=1S/C25H20BrN3O3S2/c1-16-9-12-22(26)23(13-16)29-34(31,32)21-8-4-7-20(15-21)27-25(33)28-24(30)19-11-10-17-5-2-3-6-18(17)14-19/h2-15,29H,1H3,(H2,27,28,30,33) |
| InChIKey | JTQCANYOPDOTQT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|