C24H25FN4O5S3 — CID 3601471
4-(diethylsulfamoyl)-N-[[3-[(2-fluorophenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 3601471) has the molecular formula C24H25FN4O5S3 and a molecular weight of 564.69 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[[3-[(2-fluorophenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[[3-[(2-fluorophenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3601471 |
| Molecular Formula | C24H25FN4O5S3 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[[3-[(2-fluorophenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NC(=S)Nc2cccc(S(=O)(=O)Nc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C24H25FN4O5S3/c1-3-29(4-2)37(33,34)19-14-12-17(13-15-19)23(30)27-24(35)26-18-8-7-9-20(16-18)36(31,32)28-22-11-6-5-10-21(22)25/h5-16,28H,3-4H2,1-2H3,(H2,26,27,30,35) |
| InChIKey | FZLNCEAPTXQUKD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|