C14H19N5O4S — CID 3635250
1-cyclohexyl-3-[(6-methoxy-5-nitropyridine-3-carbonyl)amino]thiourea (PubChem CID 3635250) has the molecular formula C14H19N5O4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(6-methoxy-5-nitropyridine-3-carbonyl)amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(6-methoxy-5-nitropyridine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 3635250 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-cyclohexyl-3-[(6-methoxy-5-nitropyridine-3-carbonyl)amino]thiourea |
| SMILES | COc1ncc(C(=O)NNC(=S)NC2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O4S/c1-23-13-11(19(21)22)7-9(8-15-13)12(20)17-18-14(24)16-10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3,(H,17,20)(H2,16,18,24) |
| InChIKey | AWQYBBVBUANYMY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|