C17H25N3O4S — CID 9239860
1-cyclohexyl-3-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]thiourea (PubChem CID 9239860) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9239860 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-cyclohexyl-3-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]thiourea |
| SMILES | COc1cc(CCNC(=S)NC2CCCCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H25N3O4S/c1-23-15-10-12(14(20(21)22)11-16(15)24-2)8-9-18-17(25)19-13-6-4-3-5-7-13/h10-11,13H,3-9H2,1-2H3,(H2,18,19,25) |
| InChIKey | LDQMTHUPQAISHX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|