C25H15Br3N6O4S — CID 3637831
2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-(4-nitrophenyl)-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one (PubChem CID 3637831) has the molecular formula C25H15Br3N6O4S and a molecular weight of 735.21 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-(4-nitrophenyl)-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-(4-nitrophenyl)-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3637831 |
| Molecular Formula | C25H15Br3N6O4S |
| Molecular Weight | 735.21 g/mol |
| Exact Mass | 731.84 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-(4-nitrophenyl)-4-[(2,4,6-tribromophenyl)diazenyl]-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(-n3[nH]c(-c4ccc([N+](=O)[O-])cc4)c(/N=N/c4c(Br)cc(Br)cc4Br)c3=O)n2)cc1 |
| InChI | InChI=1S/C25H15Br3N6O4S/c1-38-17-8-4-13(5-9-17)20-12-39-25(29-20)33-24(35)23(31-30-22-18(27)10-15(26)11-19(22)28)21(32-33)14-2-6-16(7-3-14)34(36)37/h2-12,32H,1H3/b31-30+ |
| InChIKey | HGNIJFFNLIBXBB-NVQSTNCTSA-N |
| XLogP | 8.58 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.21 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|