C13H11NOS — CID 3638079
2-(2,3-dihydro-1,3-benzothiazol-2-yl)phenol (PubChem CID 3638079) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 3638079 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)phenol |
| SMILES | Oc1ccccc1C1Nc2ccccc2S1 |
| InChI | InChI=1S/C13H11NOS/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,13-15H |
| InChIKey | OVJLMQOPYWHKRH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|