C24H25N3O3 — CID 3641524
[4-[3-[bis(pyridin-3-ylmethyl)amino]prop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 3641524) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [4-[3-[bis(pyridin-3-ylmethyl)amino]prop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[3-[bis(pyridin-3-ylmethyl)amino]prop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3641524 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [4-[3-[bis(pyridin-3-ylmethyl)amino]prop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=CCN(Cc2cccnc2)Cc2cccnc2)ccc1OC(C)=O |
| InChI | InChI=1S/C24H25N3O3/c1-19(28)30-23-10-9-20(14-24(23)29-2)8-5-13-27(17-21-6-3-11-25-15-21)18-22-7-4-12-26-16-22/h3-12,14-16H,13,17-18H2,1-2H3 |
| InChIKey | HOPFJHXRPDAYJV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|