C22H26N4O3S2 — CID 3642390
2-(2-ethylsulfanylbenzimidazol-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 3642390) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-(2-ethylsulfanylbenzimidazol-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-ethylsulfanylbenzimidazol-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 3642390 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-(2-ethylsulfanylbenzimidazol-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCSc1nc2ccccc2n1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-2-30-22-24-19-11-4-5-12-20(19)26(22)16-21(27)23-17-9-8-10-18(15-17)31(28,29)25-13-6-3-7-14-25/h4-5,8-12,15H,2-3,6-7,13-14,16H2,1H3,(H,23,27) |
| InChIKey | MEKSLWQNVGKOAX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |