C19H16ClN4O3S2- — CID 3645411
[4-[3-(2-chlorophenyl)prop-2-enoylamino]phenyl]sulfonyl-(5-ethyl-1,3,4-thiadiazol-2-yl)azanide (PubChem CID 3645411) has the molecular formula C19H16ClN4O3S2- and a molecular weight of 447.95 g/mol. Its IUPAC name is [4-[3-(2-chlorophenyl)prop-2-enoylamino]phenyl]sulfonyl-(5-ethyl-1,3,4-thiadiazol-2-yl)azanide.
| Compound Name | [4-[3-(2-chlorophenyl)prop-2-enoylamino]phenyl]sulfonyl-(5-ethyl-1,3,4-thiadiazol-2-yl)azanide |
|---|---|
| PubChem CID | 3645411 |
| Molecular Formula | C19H16ClN4O3S2- |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | [4-[3-(2-chlorophenyl)prop-2-enoylamino]phenyl]sulfonyl-(5-ethyl-1,3,4-thiadiazol-2-yl)azanide |
| SMILES | CCc1nnc([N-]S(=O)(=O)c2ccc(NC(=O)C=Cc3ccccc3Cl)cc2)s1 |
| InChI | InChI=1S/C19H17ClN4O3S2/c1-2-18-22-23-19(28-18)24-29(26,27)15-10-8-14(9-11-15)21-17(25)12-7-13-5-3-4-6-16(13)20/h3-12H,2H2,1H3,(H2,21,23,24,25)/p-1 |
| InChIKey | BLBZDNAZAKFHKI-UHFFFAOYSA-M |
| XLogP | 4.80 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|