C24H24FNO2 — CID 3645908
2-[4-(4-ethylcyclohexyl)phenyl]-4-[(4-fluorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3645908) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[4-(4-ethylcyclohexyl)phenyl]-4-[(4-fluorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-[4-(4-ethylcyclohexyl)phenyl]-4-[(4-fluorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3645908 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[4-(4-ethylcyclohexyl)phenyl]-4-[(4-fluorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCC1CCC(c2ccc(C3=NC(=Cc4ccc(F)cc4)C(=O)O3)cc2)CC1 |
| InChI | InChI=1S/C24H24FNO2/c1-2-16-3-7-18(8-4-16)19-9-11-20(12-10-19)23-26-22(24(27)28-23)15-17-5-13-21(25)14-6-17/h5-6,9-16,18H,2-4,7-8H2,1H3 |
| InChIKey | VOKYPZZGMHNANV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|