C9H9ClN2O2S — CID 36523236
(7-chloro-1,3-benzodioxol-5-yl)methyl carbamimidothioate (PubChem CID 36523236) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl carbamimidothioate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 36523236 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H9ClN2O2S/c10-6-1-5(3-15-9(11)12)2-7-8(6)14-4-13-7/h1-2H,3-4H2,(H3,11,12) |
| InChIKey | VCCVXBTVEZGTIL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|