C26H30Cl2N4O2 — CID 3653466
N-[2-[[1-(3,4-dichlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide (PubChem CID 3653466) has the molecular formula C26H30Cl2N4O2 and a molecular weight of 501.46 g/mol. Its IUPAC name is N-[2-[[1-(3,4-dichlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide.
| Compound Name | N-[2-[[1-(3,4-dichlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 3653466 |
| Molecular Formula | C26H30Cl2N4O2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[2-[[1-(3,4-dichlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C26H30Cl2N4O2/c1-4-5-7-12-26(34)31(18(2)3)17-25(33)29-24-16-23(19-10-8-6-9-11-19)30-32(24)20-13-14-21(27)22(28)15-20/h6,8-11,13-16,18H,4-5,7,12,17H2,1-3H3,(H,29,33) |
| InChIKey | BFFJFQPTJIQYDH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|