C28H24N4O3S3 — CID 3655034
3,6-bis(2,6-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3655034) has the molecular formula C28H24N4O3S3 and a molecular weight of 560.73 g/mol. Its IUPAC name is 3,6-bis(2,6-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3,6-bis(2,6-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3655034 |
| Molecular Formula | C28H24N4O3S3 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 3,6-bis(2,6-dimethylphenyl)-5-[(3-nitrophenyl)methylsulfanyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1cccc(C)c1-n1c(SCc2cccc([N+](=O)[O-])c2)nc2c(sc(=S)n2-c2c(C)cccc2C)c1=O |
| InChI | InChI=1S/C28H24N4O3S3/c1-16-8-5-9-17(2)22(16)30-25-24(38-28(30)36)26(33)31(23-18(3)10-6-11-19(23)4)27(29-25)37-15-20-12-7-13-21(14-20)32(34)35/h5-14H,15H2,1-4H3 |
| InChIKey | JEDJXDBWPGHHNG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|