C26H25N3O3S2 — CID 2384825
(7S)-3-(2,5-dimethylphenyl)-7-methyl-2-[(3-nitrophenyl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2384825) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-[(3-nitrophenyl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-[(3-nitrophenyl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2384825 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-[(3-nitrophenyl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C)c(-n2c(SCc3cccc([N+](=O)[O-])c3)nc3sc4c(c3c2=O)CC[C@H](C)C4)c1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-15-7-9-17(3)21(11-15)28-25(30)23-20-10-8-16(2)12-22(20)34-24(23)27-26(28)33-14-18-5-4-6-19(13-18)29(31)32/h4-7,9,11,13,16H,8,10,12,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | AIJNVDNAALGHPT-INIZCTEOSA-N |
| XLogP | 6.39 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|