C22H24N2OS2 — CID 7569779
(7S)-3-(2,5-dimethylphenyl)-7-methyl-2-prop-2-enylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7569779) has the molecular formula C22H24N2OS2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-prop-2-enylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-prop-2-enylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7569779 |
| Molecular Formula | C22H24N2OS2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (7S)-3-(2,5-dimethylphenyl)-7-methyl-2-prop-2-enylsulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCSc1nc2sc3c(c2c(=O)n1-c1cc(C)ccc1C)CC[C@H](C)C3 |
| InChI | InChI=1S/C22H24N2OS2/c1-5-10-26-22-23-20-19(16-9-7-14(3)12-18(16)27-20)21(25)24(22)17-11-13(2)6-8-15(17)4/h5-6,8,11,14H,1,7,9-10,12H2,2-4H3/t14-/m0/s1 |
| InChIKey | PMIFKISHROXWMB-AWEZNQCLSA-N |
| XLogP | 5.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|