C31H34N4O3S2 — CID 98406136
2-[[2-[[(7S)-7-methyl-3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 98406136) has the molecular formula C31H34N4O3S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is 2-[[2-[[(7S)-7-methyl-3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[2-[[(7S)-7-methyl-3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 98406136 |
| Molecular Formula | C31H34N4O3S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2-[[2-[[(7S)-7-methyl-3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccccc2C)CC[C@H](C)C4)c(C)c1 |
| InChI | InChI=1S/C31H34N4O3S2/c1-17-10-11-22-24(14-17)40-29-27(22)30(38)35(23-9-7-6-8-19(23)3)31(34-29)39-16-26(37)32-15-25(36)33-28-20(4)12-18(2)13-21(28)5/h6-9,12-13,17H,10-11,14-16H2,1-5H3,(H,32,37)(H,33,36)/t17-/m0/s1 |
| InChIKey | CJSYDAAVKMGXGE-KRWDZBQOSA-N |
| XLogP | 5.65 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |