C27H26FN3O2S2 — CID 2375793
2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-fluorophenyl)acetamide (PubChem CID 2375793) has the molecular formula C27H26FN3O2S2 and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2375793 |
| Molecular Formula | C27H26FN3O2S2 |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-fluorophenyl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(SCC(=O)Nc3cccc(F)c3)nc3sc4c(c3c2=O)CC[C@@H](C)C4)c1 |
| InChI | InChI=1S/C27H26FN3O2S2/c1-15-7-9-17(3)21(11-15)31-26(33)24-20-10-8-16(2)12-22(20)35-25(24)30-27(31)34-14-23(32)29-19-6-4-5-18(28)13-19/h4-7,9,11,13,16H,8,10,12,14H2,1-3H3,(H,29,32)/t16-/m1/s1 |
| InChIKey | OGBWTOFCKRIXQB-MRXNPFEDSA-N |
| XLogP | 6.06 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |