C24H27N3O2S2 — CID 2622292
N-cyclopropyl-2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 2622292) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-cyclopropyl-2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopropyl-2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2622292 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-cyclopropyl-2-[[(7R)-3-(2,5-dimethylphenyl)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(-n2c(SCC(=O)NC3CC3)nc3sc4c(c3c2=O)CC[C@@H](C)C4)c1 |
| InChI | InChI=1S/C24H27N3O2S2/c1-13-4-6-15(3)18(10-13)27-23(29)21-17-9-5-14(2)11-19(17)31-22(21)26-24(27)30-12-20(28)25-16-7-8-16/h4,6,10,14,16H,5,7-9,11-12H2,1-3H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | PHHBLOXYRHTABF-CQSZACIVSA-N |
| XLogP | 4.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |