C26H20N4O3S3 — CID 23877945
5-[(3-nitrophenyl)methylsulfanyl]-6-phenyl-3-(2-phenylethyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 23877945) has the molecular formula C26H20N4O3S3 and a molecular weight of 532.67 g/mol. Its IUPAC name is 5-[(3-nitrophenyl)methylsulfanyl]-6-phenyl-3-(2-phenylethyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3-nitrophenyl)methylsulfanyl]-6-phenyl-3-(2-phenylethyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 23877945 |
| Molecular Formula | C26H20N4O3S3 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 5-[(3-nitrophenyl)methylsulfanyl]-6-phenyl-3-(2-phenylethyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1c2sc(=S)n(CCc3ccccc3)c2nc(SCc2cccc([N+](=O)[O-])c2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H20N4O3S3/c31-24-22-23(28(26(34)36-22)15-14-18-8-3-1-4-9-18)27-25(29(24)20-11-5-2-6-12-20)35-17-19-10-7-13-21(16-19)30(32)33/h1-13,16H,14-15,17H2 |
| InChIKey | UDASPSWSODZAGF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|