C26H18ClN3O2S3 — CID 3635815
3-benzyl-6-(3-chlorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3635815) has the molecular formula C26H18ClN3O2S3 and a molecular weight of 536.10 g/mol. Its IUPAC name is 3-benzyl-6-(3-chlorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-6-(3-chlorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3635815 |
| Molecular Formula | C26H18ClN3O2S3 |
| Molecular Weight | 536.10 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | 3-benzyl-6-(3-chlorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=C(CSc1nc2c(sc(=S)n2Cc2ccccc2)c(=O)n1-c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C26H18ClN3O2S3/c27-19-12-7-13-20(14-19)30-24(32)22-23(29(26(33)35-22)15-17-8-3-1-4-9-17)28-25(30)34-16-21(31)18-10-5-2-6-11-18/h1-14H,15-16H2 |
| InChIKey | KCKAETDIDGPMCS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.10 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|