C24H28O8 — CID 3657660
2,3-bis[(3,4-dimethoxyphenyl)methyl]-4-ethoxy-4-oxobut-2-enoic acid (PubChem CID 3657660) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2,3-bis[(3,4-dimethoxyphenyl)methyl]-4-ethoxy-4-oxobut-2-enoic acid.
| Compound Name | 2,3-bis[(3,4-dimethoxyphenyl)methyl]-4-ethoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 3657660 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2,3-bis[(3,4-dimethoxyphenyl)methyl]-4-ethoxy-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)C(Cc1ccc(OC)c(OC)c1)=C(Cc1ccc(OC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C24H28O8/c1-6-32-24(27)18(12-16-8-10-20(29-3)22(14-16)31-5)17(23(25)26)11-15-7-9-19(28-2)21(13-15)30-4/h7-10,13-14H,6,11-12H2,1-5H3,(H,25,26) |
| InChIKey | LZLZLVQMXFQGGI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|