C24H25BrN4O3 — CID 36577291
N'-[1-(4-bromophenyl)cyclopropanecarbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 36577291) has the molecular formula C24H25BrN4O3 and a molecular weight of 497.39 g/mol. Its IUPAC name is N'-[1-(4-bromophenyl)cyclopropanecarbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[1-(4-bromophenyl)cyclopropanecarbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 36577291 |
| Molecular Formula | C24H25BrN4O3 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N'-[1-(4-bromophenyl)cyclopropanecarbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)C2(c3ccc(Br)cc3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H25BrN4O3/c1-2-3-6-15-29-22(31)19-8-5-4-7-18(19)20(28-29)21(30)26-27-23(32)24(13-14-24)16-9-11-17(25)12-10-16/h4-5,7-12H,2-3,6,13-15H2,1H3,(H,26,30)(H,27,32) |
| InChIKey | BPEFGLINLJWNRC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|