C18H28N4O2+2 — CID 3659582
N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-4-(morpholin-4-ium-4-ylmethyl)benzohydrazide (PubChem CID 3659582) has the molecular formula C18H28N4O2+2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-4-(morpholin-4-ium-4-ylmethyl)benzohydrazide.
| Compound Name | N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-4-(morpholin-4-ium-4-ylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 3659582 |
| Molecular Formula | C18H28N4O2+2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-4-(morpholin-4-ium-4-ylmethyl)benzohydrazide |
| SMILES | C[NH+]1CC=C(NNC(=O)c2ccc(C[NH+]3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-21-8-6-17(7-9-21)19-20-18(23)16-4-2-15(3-5-16)14-22-10-12-24-13-11-22/h2-6,19H,7-14H2,1H3,(H,20,23)/p+2 |
| InChIKey | RXKYZCOBKRBFIT-UHFFFAOYSA-P |
| XLogP | -1.86 |
| TPSA | 59.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|