C14H10F9N5O — CID 3666489
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-[2-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 3666489) has the molecular formula C14H10F9N5O and a molecular weight of 435.25 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-[2-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-[2-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3666489 |
| Molecular Formula | C14H10F9N5O |
| Molecular Weight | 435.25 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-[2-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2C(F)(F)F)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H10F9N5O/c1-24-9-26-10(25-7-5-3-2-4-6(7)12(15,16)17)28-11(27-9)29-8(13(18,19)20)14(21,22)23/h2-5,8H,1H3,(H2,24,25,26,27,28) |
| InChIKey | CIIUMRDNVXRGHR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |