C17H14F2IN3OS — CID 36689519
1-(2,4-difluorophenyl)-1-[(5S)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 36689519) has the molecular formula C17H14F2IN3OS and a molecular weight of 473.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-1-[(5S)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-(2,4-difluorophenyl)-1-[(5S)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 36689519 |
| Molecular Formula | C17H14F2IN3OS |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 1-(2,4-difluorophenyl)-1-[(5S)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(C1=NC[C@@H](CI)S1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2IN3OS/c18-11-6-7-15(14(19)8-11)23(17-21-10-13(9-20)25-17)16(24)22-12-4-2-1-3-5-12/h1-8,13H,9-10H2,(H,22,24)/t13-/m1/s1 |
| InChIKey | MYXWVAAOLVVCHA-CYBMUJFWSA-N |
| XLogP | 4.91 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|