C8H9N2O5S- — CID 36691339
3-acetamido-5-amino-4-hydroxybenzenesulfonate (PubChem CID 36691339) has the molecular formula C8H9N2O5S- and a molecular weight of 245.24 g/mol. Its IUPAC name is 3-acetamido-5-amino-4-hydroxybenzenesulfonate.
| Compound Name | 3-acetamido-5-amino-4-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 36691339 |
| Molecular Formula | C8H9N2O5S- |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-acetamido-5-amino-4-hydroxybenzenesulfonate |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)[O-])cc(N)c1O |
| InChI | InChI=1S/C8H10N2O5S/c1-4(11)10-7-3-5(16(13,14)15)2-6(9)8(7)12/h2-3,12H,9H2,1H3,(H,10,11)(H,13,14,15)/p-1 |
| InChIKey | SFUJTLIHMWZDTL-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|