C14H12Cl2N2O4S — CID 88792568
(3,5-dichlorophenyl) 4-acetamido-3-aminobenzenesulfonate (PubChem CID 88792568) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 4-acetamido-3-aminobenzenesulfonate.
| Compound Name | (3,5-dichlorophenyl) 4-acetamido-3-aminobenzenesulfonate |
|---|---|
| PubChem CID | 88792568 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | (3,5-dichlorophenyl) 4-acetamido-3-aminobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2cc(Cl)cc(Cl)c2)cc1N |
| InChI | InChI=1S/C14H12Cl2N2O4S/c1-8(19)18-14-3-2-12(7-13(14)17)23(20,21)22-11-5-9(15)4-10(16)6-11/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | DCOIULIWQMYBSG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|