C30H29N3O5 — CID 3672135
[3-[2-[(2-methylbenzoyl)amino]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-enyl]phenyl] acetate (PubChem CID 3672135) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is [3-[2-[(2-methylbenzoyl)amino]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-enyl]phenyl] acetate.
| Compound Name | [3-[2-[(2-methylbenzoyl)amino]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 3672135 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | [3-[2-[(2-methylbenzoyl)amino]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C=C(NC(=O)c2ccccc2C)C(=O)N2CC3CC(C2)c2cccc(=O)n2C3)c1 |
| InChI | InChI=1S/C30H29N3O5/c1-19-7-3-4-10-25(19)29(36)31-26(15-21-8-5-9-24(14-21)38-20(2)34)30(37)32-16-22-13-23(18-32)27-11-6-12-28(35)33(27)17-22/h3-12,14-15,22-23H,13,16-18H2,1-2H3,(H,31,36) |
| InChIKey | NQRVVEHXSUSJJN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|