C31H33FN4O3 — CID 6385069
N-[(Z)-1-[4-(diethylamino)phenyl]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-4-fluorobenzamide (PubChem CID 6385069) has the molecular formula C31H33FN4O3 and a molecular weight of 528.63 g/mol. Its IUPAC name is N-[(Z)-1-[4-(diethylamino)phenyl]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(Z)-1-[4-(diethylamino)phenyl]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 6385069 |
| Molecular Formula | C31H33FN4O3 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-[(Z)-1-[4-(diethylamino)phenyl]-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-4-fluorobenzamide |
| SMILES | CCN(CC)c1ccc(/C=C(\NC(=O)c2ccc(F)cc2)C(=O)N2CC3CC(C2)c2cccc(=O)n2C3)cc1 |
| InChI | InChI=1S/C31H33FN4O3/c1-3-34(4-2)26-14-8-21(9-15-26)17-27(33-30(38)23-10-12-25(32)13-11-23)31(39)35-18-22-16-24(20-35)28-6-5-7-29(37)36(28)19-22/h5-15,17,22,24H,3-4,16,18-20H2,1-2H3,(H,33,38)/b27-17- |
| InChIKey | LLXCFZBXGLWROW-PKAZHMFMSA-N |
| XLogP | 4.25 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|