C25H21Cl2N3O4 — CID 98144445
N-[(E)-1-(3,4-dichlorophenyl)-3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]furan-2-carboxamide (PubChem CID 98144445) has the molecular formula C25H21Cl2N3O4 and a molecular weight of 498.37 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dichlorophenyl)-3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(E)-1-(3,4-dichlorophenyl)-3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 98144445 |
| Molecular Formula | C25H21Cl2N3O4 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[(E)-1-(3,4-dichlorophenyl)-3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(N/C(=C/c1ccc(Cl)c(Cl)c1)C(=O)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2)c1ccco1 |
| InChI | InChI=1S/C25H21Cl2N3O4/c26-18-7-6-15(10-19(18)27)11-20(28-24(32)22-4-2-8-34-22)25(33)29-12-16-9-17(14-29)21-3-1-5-23(31)30(21)13-16/h1-8,10-11,16-17H,9,12-14H2,(H,28,32)/b20-11+/t16-,17-/m0/s1 |
| InChIKey | BBIPBBIFDUJWFY-FNPLVTCOSA-N |
| XLogP | 4.16 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|