C17H17ClN4O2 — CID 3677871
N-(2-chloro-5-methoxyphenyl)-2-cyano-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 3677871) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2-cyano-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2-cyano-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3677871 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2-cyano-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | COc1ccc(Cl)c(NC(=O)C(C#N)=Cc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-10-14(11(2)22(3)21-10)7-12(9-19)17(23)20-16-8-13(24-4)5-6-15(16)18/h5-8H,1-4H3,(H,20,23) |
| InChIKey | VWBUXZXOXANBSR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|