C23H25ClN4O3 — CID 3680467
4-[(5-chloroquinolin-8-yl)oxymethyl]-N-(1,6-diamino-1-oxohexan-2-yl)benzamide (PubChem CID 3680467) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[(5-chloroquinolin-8-yl)oxymethyl]-N-(1,6-diamino-1-oxohexan-2-yl)benzamide.
| Compound Name | 4-[(5-chloroquinolin-8-yl)oxymethyl]-N-(1,6-diamino-1-oxohexan-2-yl)benzamide |
|---|---|
| PubChem CID | 3680467 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[(5-chloroquinolin-8-yl)oxymethyl]-N-(1,6-diamino-1-oxohexan-2-yl)benzamide |
| SMILES | NCCCCC(NC(=O)c1ccc(COc2ccc(Cl)c3cccnc23)cc1)C(N)=O |
| InChI | InChI=1S/C23H25ClN4O3/c24-18-10-11-20(21-17(18)4-3-13-27-21)31-14-15-6-8-16(9-7-15)23(30)28-19(22(26)29)5-1-2-12-25/h3-4,6-11,13,19H,1-2,5,12,14,25H2,(H2,26,29)(H,28,30) |
| InChIKey | NNSWLPKDDHLCHD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|