C22H25FN2O3 — CID 36855400
N'-[2-(3,5-dimethylphenoxy)acetyl]-1-(3-fluorophenyl)cyclopentane-1-carbohydrazide (PubChem CID 36855400) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenoxy)acetyl]-1-(3-fluorophenyl)cyclopentane-1-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-1-(3-fluorophenyl)cyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 36855400 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-1-(3-fluorophenyl)cyclopentane-1-carbohydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)C2(c3cccc(F)c3)CCCC2)c1 |
| InChI | InChI=1S/C22H25FN2O3/c1-15-10-16(2)12-19(11-15)28-14-20(26)24-25-21(27)22(8-3-4-9-22)17-6-5-7-18(23)13-17/h5-7,10-13H,3-4,8-9,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | WXHFPXJECVEATB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|