C28H22N2O4S — CID 3687459
1-(2,2-diphenylacetyl)-3-(2-methylphenyl)sulfonylbenzimidazol-2-one (PubChem CID 3687459) has the molecular formula C28H22N2O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is 1-(2,2-diphenylacetyl)-3-(2-methylphenyl)sulfonylbenzimidazol-2-one.
| Compound Name | 1-(2,2-diphenylacetyl)-3-(2-methylphenyl)sulfonylbenzimidazol-2-one |
|---|---|
| PubChem CID | 3687459 |
| Molecular Formula | C28H22N2O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-(2,2-diphenylacetyl)-3-(2-methylphenyl)sulfonylbenzimidazol-2-one |
| SMILES | Cc1ccccc1S(=O)(=O)n1c(=O)n(C(=O)C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H22N2O4S/c1-20-12-8-11-19-25(20)35(33,34)30-24-18-10-9-17-23(24)29(28(30)32)27(31)26(21-13-4-2-5-14-21)22-15-6-3-7-16-22/h2-19,26H,1H3 |
| InChIKey | HKSHVFRRAHVVCZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |