C13H12F3N5OS — CID 3694149
2-(4-amino-6-methylpyrimidin-2-yl)-5-thiophen-2-yl-3-(trifluoromethyl)-4H-pyrazol-3-ol (PubChem CID 3694149) has the molecular formula C13H12F3N5OS and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)-5-thiophen-2-yl-3-(trifluoromethyl)-4H-pyrazol-3-ol.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)-5-thiophen-2-yl-3-(trifluoromethyl)-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 3694149 |
| Molecular Formula | C13H12F3N5OS |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)-5-thiophen-2-yl-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| SMILES | Cc1cc(N)nc(N2N=C(c3cccs3)CC2(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H12F3N5OS/c1-7-5-10(17)19-11(18-7)21-12(22,13(14,15)16)6-8(20-21)9-3-2-4-23-9/h2-5,22H,6H2,1H3,(H2,17,18,19) |
| InChIKey | SNYZKCNRXGRMGH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |