C17H12F3I2N3O4 — CID 3698919
N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 3698919) has the molecular formula C17H12F3I2N3O4 and a molecular weight of 633.10 g/mol. Its IUPAC name is N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3698919 |
| Molecular Formula | C17H12F3I2N3O4 |
| Molecular Weight | 633.10 g/mol |
| Exact Mass | 632.89 |
| IUPAC Name | N-[(3,5-diiodo-2-methoxyphenyl)methylideneamino]-2-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1c(I)cc(I)cc1C=NNC(=O)Cc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12F3I2N3O4/c1-29-16-10(4-12(21)7-13(16)22)8-23-24-15(26)5-9-2-3-11(17(18,19)20)6-14(9)25(27)28/h2-4,6-8H,5H2,1H3,(H,24,26) |
| InChIKey | PWAOHWOUVGAKBZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.10 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|