About 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide
1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide (PubChem CID 37004925) has the molecular formula C19H24N4O3
and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide.
Molecular Properties
| Compound Name | 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide |
| PubChem CID | 37004925 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide |
| SMILES | CC(C)CN1C[C@@H](C(=O)NNC(=O)c2cn(C)c3ccccc23)CC1=O |
| InChI | InChI=1S/C19H24N4O3/c1-12(2)9-23-10-13(8-17(23)24)18(25)20-21-19(26)15-11-22(3)16-7-5-4-6-14(15)16/h4-7,11-13H,8-10H2,1-3H3,(H,20,25)(H,21,26)/t13-/m0/s1 |
| InChIKey | NOCJEWVAPHKYGV-ZDUSSCGKSA-N |
| XLogP | 1.44 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide?
The IUPAC name of 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide (CID 37004925) is 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide.
What is the SMILES notation for 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide?
The canonical SMILES for 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide is CC(C)CN1C[C@@H](C(=O)NNC(=O)c2cn(C)c3ccccc23)CC1=O.
What is the InChIKey of 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide?
The InChIKey is NOCJEWVAPHKYGV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H24N4O3/c1-12(2)9-23-10-13(8-17(23)24)18(25)20-21-19(26)15-11-22(3)16-7-5-4-6-14(15)16/h4-7,11-13H,8-10H2,1-3H3,(H,20,25)(H,21,26)/t13-/m0/s1.
What are the key properties of 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide?
1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide has a molecular weight of 356.43 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N'-[(3S)-1-(2-methylpropyl)-5-oxopyrrolidine-3-carbonyl]indole-3-carbohydrazide is sourced from PubChem (CID 37004925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).