C25H28N2O4S2 — CID 3702545
N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 3702545) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3702545 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | CCCC#CCCSc1nc2ccc(NC(=O)Cc3ccc(OC)c(OC)c3OC)cc2s1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-5-6-7-8-9-14-32-25-27-19-12-11-18(16-21(19)33-25)26-22(28)15-17-10-13-20(29-2)24(31-4)23(17)30-3/h10-13,16H,5-6,9,14-15H2,1-4H3,(H,26,28) |
| InChIKey | ZCXILOUDFNAGMP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|