C23H22N2O3S2 — CID 3861361
N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-4-oxo-6,7-dihydro-5H-1-benzofuran-3-carboxamide (PubChem CID 3861361) has the molecular formula C23H22N2O3S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-4-oxo-6,7-dihydro-5H-1-benzofuran-3-carboxamide.
| Compound Name | N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-4-oxo-6,7-dihydro-5H-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 3861361 |
| Molecular Formula | C23H22N2O3S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)-4-oxo-6,7-dihydro-5H-1-benzofuran-3-carboxamide |
| SMILES | CCCC#CCCSc1nc2ccc(NC(=O)c3coc4c3C(=O)CCC4)cc2s1 |
| InChI | InChI=1S/C23H22N2O3S2/c1-2-3-4-5-6-12-29-23-25-17-11-10-15(13-20(17)30-23)24-22(27)16-14-28-19-9-7-8-18(26)21(16)19/h10-11,13-14H,2-3,6-9,12H2,1H3,(H,24,27) |
| InChIKey | MDPUIYINPZQIFJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|