C20H25N3O3S3 — CID 3697538
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)acetamide (PubChem CID 3697538) has the molecular formula C20H25N3O3S3 and a molecular weight of 451.64 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)acetamide |
|---|---|
| PubChem CID | 3697538 |
| Molecular Formula | C20H25N3O3S3 |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-hept-3-ynylsulfanyl-1,3-benzothiazol-6-yl)acetamide |
| SMILES | CCCC#CCCSc1nc2ccc(NC(=O)CN3CCS(=O)(=O)CC3)cc2s1 |
| InChI | InChI=1S/C20H25N3O3S3/c1-2-3-4-5-6-11-27-20-22-17-8-7-16(14-18(17)28-20)21-19(24)15-23-9-12-29(25,26)13-10-23/h7-8,14H,2-3,6,9-13,15H2,1H3,(H,21,24) |
| InChIKey | TYHIUTLUQMGZRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|