About 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine
1-fluoro-3-methyl-1,1-diphenylbutan-2-amine (PubChem CID 3702655) has the molecular formula C17H20FN
and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine.
Molecular Properties
| Compound Name | 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine |
| PubChem CID | 3702655 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine |
| SMILES | CC(C)C(N)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20FN/c1-13(2)16(19)17(18,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,19H2,1-2H3 |
| InChIKey | MJIXRSWLVFUMCB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine?
The IUPAC name of 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine (CID 3702655) is 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine.
What is the SMILES notation for 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine?
The canonical SMILES for 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine is CC(C)C(N)C(F)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine?
The InChIKey is MJIXRSWLVFUMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN/c1-13(2)16(19)17(18,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,19H2,1-2H3.
What are the key properties of 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine?
1-fluoro-3-methyl-1,1-diphenylbutan-2-amine has a molecular weight of 257.35 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-methyl-1,1-diphenylbutan-2-amine is sourced from PubChem (CID 3702655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).