C19H22N2 — CID 3704369
N,N'-bis(1-phenylpropan-2-yl)methanediimine (PubChem CID 3704369) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N,N'-bis(1-phenylpropan-2-yl)methanediimine.
| Compound Name | N,N'-bis(1-phenylpropan-2-yl)methanediimine |
|---|---|
| PubChem CID | 3704369 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N,N'-bis(1-phenylpropan-2-yl)methanediimine |
| SMILES | CC(Cc1ccccc1)N=C=NC(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-16(13-18-9-5-3-6-10-18)20-15-21-17(2)14-19-11-7-4-8-12-19/h3-12,16-17H,13-14H2,1-2H3 |
| InChIKey | WHUADTLYVGNCOV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|