C16H20FN3O3 — CID 3710932
5-ethyl-3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 3710932) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-ethyl-3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 5-ethyl-3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3710932 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 5-ethyl-3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CCC1CN(C2CCN(C(=O)c3cccnc3F)CC2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN3O3/c1-2-12-10-20(16(22)23-12)11-5-8-19(9-6-11)15(21)13-4-3-7-18-14(13)17/h3-4,7,11-12H,2,5-6,8-10H2,1H3 |
| InChIKey | LJLMOZKQLQTVOQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|