C19H24FN3O3 — CID 3834044
3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 3834044) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | 3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 3834044 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-[1-(2-fluoropyridine-3-carbonyl)piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | O=C(c1cccnc1F)N1CCC(N2CC3(CCCCC3)OC2=O)CC1 |
| InChI | InChI=1S/C19H24FN3O3/c20-16-15(5-4-10-21-16)17(24)22-11-6-14(7-12-22)23-13-19(26-18(23)25)8-2-1-3-9-19/h4-5,10,14H,1-3,6-9,11-13H2 |
| InChIKey | ZYDAXOOZZKFABQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|