C23H30N2O5S — CID 3534413
3-[1-[2-(2-phenylethenylsulfonyl)acetyl]piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 3534413) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[1-[2-(2-phenylethenylsulfonyl)acetyl]piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | 3-[1-[2-(2-phenylethenylsulfonyl)acetyl]piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 3534413 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-[1-[2-(2-phenylethenylsulfonyl)acetyl]piperidin-4-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | O=C(CS(=O)(=O)C=Cc1ccccc1)N1CCC(N2CC3(CCCCC3)OC2=O)CC1 |
| InChI | InChI=1S/C23H30N2O5S/c26-21(17-31(28,29)16-11-19-7-3-1-4-8-19)24-14-9-20(10-15-24)25-18-23(30-22(25)27)12-5-2-6-13-23/h1,3-4,7-8,11,16,20H,2,5-6,9-10,12-15,17-18H2 |
| InChIKey | RXAXBQRMHICGHZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |