C25H28N2O3S — CID 3811625
5-phenyl-3-[1-[3-(2-phenylethenylsulfanyl)propanoyl]piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 3811625) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 5-phenyl-3-[1-[3-(2-phenylethenylsulfanyl)propanoyl]piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 5-phenyl-3-[1-[3-(2-phenylethenylsulfanyl)propanoyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3811625 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-phenyl-3-[1-[3-(2-phenylethenylsulfanyl)propanoyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCSC=Cc1ccccc1)N1CCC(N2CC(c3ccccc3)OC2=O)CC1 |
| InChI | InChI=1S/C25H28N2O3S/c28-24(14-18-31-17-13-20-7-3-1-4-8-20)26-15-11-22(12-16-26)27-19-23(30-25(27)29)21-9-5-2-6-10-21/h1-10,13,17,22-23H,11-12,14-16,18-19H2 |
| InChIKey | GZLWCNATHFWGPL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|