C15H12ClN3OS2 — CID 3711776
2-[amino-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]methylidene]-3-oxobutanenitrile (PubChem CID 3711776) has the molecular formula C15H12ClN3OS2 and a molecular weight of 349.87 g/mol. Its IUPAC name is 2-[amino-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]methylidene]-3-oxobutanenitrile.
| Compound Name | 2-[amino-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 3711776 |
| Molecular Formula | C15H12ClN3OS2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-[amino-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]methylidene]-3-oxobutanenitrile |
| SMILES | CC(=O)C(C#N)=C(N)SCc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H12ClN3OS2/c1-9(20)13(6-17)14(18)21-7-12-8-22-15(19-12)10-2-4-11(16)5-3-10/h2-5,8H,7,18H2,1H3 |
| InChIKey | YSBWTPHSHRLKRW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|