C23H20FNO3 — CID 37236944
[2-(2-benzylanilino)-2-oxoethyl] 5-fluoro-2-methylbenzoate (PubChem CID 37236944) has the molecular formula C23H20FNO3 and a molecular weight of 377.42 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl] 5-fluoro-2-methylbenzoate.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl] 5-fluoro-2-methylbenzoate |
|---|---|
| PubChem CID | 37236944 |
| Molecular Formula | C23H20FNO3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl] 5-fluoro-2-methylbenzoate |
| SMILES | Cc1ccc(F)cc1C(=O)OCC(=O)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C23H20FNO3/c1-16-11-12-19(24)14-20(16)23(27)28-15-22(26)25-21-10-6-5-9-18(21)13-17-7-3-2-4-8-17/h2-12,14H,13,15H2,1H3,(H,25,26) |
| InChIKey | HHQWMSJTQHNACQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |